| Name | tri(propylene glycol) butyl ether, mixture O |
| Synonyms | TPNB DOWANOL(TM) TPNB ARCOSOLV (R) TPNB Tripropyleneglycoln-butylether Tripropyleneglycolmonobutylether TRI(PROPYLENE GLYCOL) BUTYL ETHER TRIPROPYLENE GLYCOL NORMAL BUTYL ETHER 3-[3-(3-butoxypropoxy)propoxy]propan-1-ol tri(propylene glycol) butyl ether, mixture O Tri(propylene glycol) butyl ether,mixture of isomers 1-[2-(2-butoxy-1-methylethoxy)-1-methylethoxy]propan-2-ol 3-{2-[(5-ethoxypentan-2-yl)oxy]ethoxy}-2-methylpropan-1-ol |
| CAS | 55934-93-5 |
| EINECS | 259-910-3 |
| InChI | InChI=1/C9H20O4.C8H18O/c1-7(11)5-12-9(3)6-13-8(2)4-10;1-3-5-7-9-8-6-4-2/h7-11H,4-6H2,1-3H3;3-8H2,1-2H3 |
| InChIKey | QSSDFXGXUGCLSY-UHFFFAOYSA-N |
| Molecular Formula | C13H28O4 |
| Molar Mass | 248.36 |
| Density | 0.932g/mLat 25°C(lit.) |
| Melting Point | −75°C(lit.) |
| Boling Point | 276°C(lit.) |
| Flash Point | >230°F |
| Water Solubility | 40.2g/L at 20℃ |
| Vapor Presure | 0.2Pa at 20℃ |
| Refractive Index | n20/D 1.432(lit.) |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 1 |
| LogP | 1.9 at 20℃ |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |